C12H20N2O — CID 168683470
1-[(1S,2S)-2-aminocyclohexyl]-4-ethenylpyrrolidin-2-one (PubChem CID 168683470) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is 1-[(1S,2S)-2-aminocyclohexyl]-4-ethenylpyrrolidin-2-one.
| Compound Name | 1-[(1S,2S)-2-aminocyclohexyl]-4-ethenylpyrrolidin-2-one |
|---|---|
| PubChem CID | 168683470 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 1-[(1S,2S)-2-aminocyclohexyl]-4-ethenylpyrrolidin-2-one |
| SMILES | C=CC1CC(=O)N([C@H]2CCCC[C@@H]2N)C1 |
| InChI | InChI=1S/C12H20N2O/c1-2-9-7-12(15)14(8-9)11-6-4-3-5-10(11)13/h2,9-11H,1,3-8,13H2/t9?,10-,11-/m0/s1 |
| InChIKey | QQKNDRWXZFGFRZ-DVRYWGNFSA-N |
| XLogP | 1.29 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|