C10H17ClN2O — CID 168686792
1-[(1S,2S)-2-aminocyclohexyl]-4-chloropyrrolidin-2-one (PubChem CID 168686792) has the molecular formula C10H17ClN2O and a molecular weight of 216.71 g/mol. Its IUPAC name is 1-[(1S,2S)-2-aminocyclohexyl]-4-chloropyrrolidin-2-one.
| Compound Name | 1-[(1S,2S)-2-aminocyclohexyl]-4-chloropyrrolidin-2-one |
|---|---|
| PubChem CID | 168686792 |
| Molecular Formula | C10H17ClN2O |
| Molecular Weight | 216.71 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | 1-[(1S,2S)-2-aminocyclohexyl]-4-chloropyrrolidin-2-one |
| SMILES | N[C@H]1CCCC[C@@H]1N1CC(Cl)CC1=O |
| InChI | InChI=1S/C10H17ClN2O/c11-7-5-10(14)13(6-7)9-4-2-1-3-8(9)12/h7-9H,1-6,12H2/t7?,8-,9-/m0/s1 |
| InChIKey | WNOHLQWRXHDFRY-NPPUSCPJSA-N |
| XLogP | 1.10 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.71 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|