C10H19N3O3S — CID 168716381
1-(2-aminocyclohexyl)-5-oxopyrrolidine-3-sulfonamide (PubChem CID 168716381) has the molecular formula C10H19N3O3S and a molecular weight of 261.35 g/mol. Its IUPAC name is 1-(2-aminocyclohexyl)-5-oxopyrrolidine-3-sulfonamide.
| Compound Name | 1-(2-aminocyclohexyl)-5-oxopyrrolidine-3-sulfonamide |
|---|---|
| PubChem CID | 168716381 |
| Molecular Formula | C10H19N3O3S |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 1-(2-aminocyclohexyl)-5-oxopyrrolidine-3-sulfonamide |
| SMILES | NC1CCCCC1N1CC(S(N)(=O)=O)CC1=O |
| InChI | InChI=1S/C10H19N3O3S/c11-8-3-1-2-4-9(8)13-6-7(5-10(13)14)17(12,15)16/h7-9H,1-6,11H2,(H2,12,15,16) |
| InChIKey | SKLLFBRCDKXMBY-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 106.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |