C12H22N2O3S — CID 168716348
1-(2,3-dimethylcyclohexyl)-5-oxopyrrolidine-3-sulfonamide (PubChem CID 168716348) has the molecular formula C12H22N2O3S and a molecular weight of 274.39 g/mol. Its IUPAC name is 1-(2,3-dimethylcyclohexyl)-5-oxopyrrolidine-3-sulfonamide.
| Compound Name | 1-(2,3-dimethylcyclohexyl)-5-oxopyrrolidine-3-sulfonamide |
|---|---|
| PubChem CID | 168716348 |
| Molecular Formula | C12H22N2O3S |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 1-(2,3-dimethylcyclohexyl)-5-oxopyrrolidine-3-sulfonamide |
| SMILES | CC1CCCC(N2CC(S(N)(=O)=O)CC2=O)C1C |
| InChI | InChI=1S/C12H22N2O3S/c1-8-4-3-5-11(9(8)2)14-7-10(6-12(14)15)18(13,16)17/h8-11H,3-7H2,1-2H3,(H2,13,16,17) |
| InChIKey | ROBIPYPUDRGNRB-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |