C15H27N3O5S — CID 168716353
tert-butyl N-[2-(2-oxo-4-sulfamoylpyrrolidin-1-yl)cyclohexyl]carbamate (PubChem CID 168716353) has the molecular formula C15H27N3O5S and a molecular weight of 361.46 g/mol. Its IUPAC name is tert-butyl N-[2-(2-oxo-4-sulfamoylpyrrolidin-1-yl)cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[2-(2-oxo-4-sulfamoylpyrrolidin-1-yl)cyclohexyl]carbamate |
|---|---|
| PubChem CID | 168716353 |
| Molecular Formula | C15H27N3O5S |
| Molecular Weight | 361.46 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | tert-butyl N-[2-(2-oxo-4-sulfamoylpyrrolidin-1-yl)cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCCCC1N1CC(S(N)(=O)=O)CC1=O |
| InChI | InChI=1S/C15H27N3O5S/c1-15(2,3)23-14(20)17-11-6-4-5-7-12(11)18-9-10(8-13(18)19)24(16,21)22/h10-12H,4-9H2,1-3H3,(H,17,20)(H2,16,21,22) |
| InChIKey | RLIVDSIBMJHSML-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.46 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |