C15H17NO4 — CID 101169881
[(1R,2R,5S)-3-oxo-8-azabicyclo[3.2.1]octan-2-yl] 3-methoxybenzoate (PubChem CID 101169881) has the molecular formula C15H17NO4 and a molecular weight of 275.30 g/mol. Its IUPAC name is [(1R,2R,5S)-3-oxo-8-azabicyclo[3.2.1]octan-2-yl] 3-methoxybenzoate.
| Compound Name | [(1R,2R,5S)-3-oxo-8-azabicyclo[3.2.1]octan-2-yl] 3-methoxybenzoate |
|---|---|
| PubChem CID | 101169881 |
| Molecular Formula | C15H17NO4 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | [(1R,2R,5S)-3-oxo-8-azabicyclo[3.2.1]octan-2-yl] 3-methoxybenzoate |
| SMILES | COc1cccc(C(=O)O[C@H]2C(=O)C[C@@H]3CC[C@H]2N3)c1 |
| InChI | InChI=1S/C15H17NO4/c1-19-11-4-2-3-9(7-11)15(18)20-14-12-6-5-10(16-12)8-13(14)17/h2-4,7,10,12,14,16H,5-6,8H2,1H3/t10-,12+,14+/m0/s1 |
| InChIKey | SLXOIWCOWTVKTH-ZKYQVNSYSA-N |
| XLogP | 1.31 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |