C15H19NO3 — CID 11276989
[(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl] 3-methoxybenzoate (PubChem CID 11276989) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is [(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl] 3-methoxybenzoate.
| Compound Name | [(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl] 3-methoxybenzoate |
|---|---|
| PubChem CID | 11276989 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | [(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl] 3-methoxybenzoate |
| SMILES | COc1cccc(C(=O)OC2C[C@H]3CC[C@@H](C2)N3)c1 |
| InChI | InChI=1S/C15H19NO3/c1-18-13-4-2-3-10(7-13)15(17)19-14-8-11-5-6-12(9-14)16-11/h2-4,7,11-12,14,16H,5-6,8-9H2,1H3/t11-,12+,14? |
| InChIKey | GWVGSKHNJYDCEQ-ONXXMXGDSA-N |
| XLogP | 2.13 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |