C7H6BrF2NO2 — CID 119000477
2-bromo-5-(difluoromethyl)-3-methoxy-1H-pyridin-4-one (PubChem CID 119000477) has the molecular formula C7H6BrF2NO2 and a molecular weight of 254.03 g/mol. Its IUPAC name is 2-bromo-5-(difluoromethyl)-3-methoxy-1H-pyridin-4-one.
| Compound Name | 2-bromo-5-(difluoromethyl)-3-methoxy-1H-pyridin-4-one |
|---|---|
| PubChem CID | 119000477 |
| Molecular Formula | C7H6BrF2NO2 |
| Molecular Weight | 254.03 g/mol |
| Exact Mass | 252.95 |
| IUPAC Name | 2-bromo-5-(difluoromethyl)-3-methoxy-1H-pyridin-4-one |
| SMILES | COc1c(Br)[nH]cc(C(F)F)c1=O |
| InChI | InChI=1S/C7H6BrF2NO2/c1-13-5-4(12)3(7(9)10)2-11-6(5)8/h2,7H,1H3,(H,11,12) |
| InChIKey | YMIBHUUVENOFMG-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.03 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|