C10H8F6O2 — CID 119001225
[3-methoxy-2,4-bis(trifluoromethyl)phenyl]methanol (PubChem CID 119001225) has the molecular formula C10H8F6O2 and a molecular weight of 274.16 g/mol. Its IUPAC name is [3-methoxy-2,4-bis(trifluoromethyl)phenyl]methanol.
| Compound Name | [3-methoxy-2,4-bis(trifluoromethyl)phenyl]methanol |
|---|---|
| PubChem CID | 119001225 |
| Molecular Formula | C10H8F6O2 |
| Molecular Weight | 274.16 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | [3-methoxy-2,4-bis(trifluoromethyl)phenyl]methanol |
| SMILES | COc1c(C(F)(F)F)ccc(CO)c1C(F)(F)F |
| InChI | InChI=1S/C10H8F6O2/c1-18-8-6(9(11,12)13)3-2-5(4-17)7(8)10(14,15)16/h2-3,17H,4H2,1H3 |
| InChIKey | KOYSVQPUWFUEAA-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.16 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |