C8H5F2N3O — CID 119001249
6-amino-5-(difluoromethyl)-2-formylpyridine-3-carbonitrile (PubChem CID 119001249) has the molecular formula C8H5F2N3O and a molecular weight of 197.14 g/mol. Its IUPAC name is 6-amino-5-(difluoromethyl)-2-formylpyridine-3-carbonitrile.
| Compound Name | 6-amino-5-(difluoromethyl)-2-formylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 119001249 |
| Molecular Formula | C8H5F2N3O |
| Molecular Weight | 197.14 g/mol |
| Exact Mass | 197.04 |
| IUPAC Name | 6-amino-5-(difluoromethyl)-2-formylpyridine-3-carbonitrile |
| SMILES | N#Cc1cc(C(F)F)c(N)nc1C=O |
| InChI | InChI=1S/C8H5F2N3O/c9-7(10)5-1-4(2-11)6(3-14)13-8(5)12/h1,3,7H,(H2,12,13) |
| InChIKey | UWPUXLXTEYWITI-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 79.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.14 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|