C8H4F5N3 — CID 119014969
6-amino-5-(difluoromethyl)-2-(trifluoromethyl)pyridine-3-carbonitrile (PubChem CID 119014969) has the molecular formula C8H4F5N3 and a molecular weight of 237.13 g/mol. Its IUPAC name is 6-amino-5-(difluoromethyl)-2-(trifluoromethyl)pyridine-3-carbonitrile.
| Compound Name | 6-amino-5-(difluoromethyl)-2-(trifluoromethyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 119014969 |
| Molecular Formula | C8H4F5N3 |
| Molecular Weight | 237.13 g/mol |
| Exact Mass | 237.03 |
| IUPAC Name | 6-amino-5-(difluoromethyl)-2-(trifluoromethyl)pyridine-3-carbonitrile |
| SMILES | N#Cc1cc(C(F)F)c(N)nc1C(F)(F)F |
| InChI | InChI=1S/C8H4F5N3/c9-6(10)4-1-3(2-14)5(8(11,12)13)16-7(4)15/h1,6H,(H2,15,16) |
| InChIKey | LMEWEYHKIPHCSA-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.13 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |