C8H7F5N2 — CID 119019045
3-(difluoromethyl)-5-methyl-6-(trifluoromethyl)pyridin-2-amine (PubChem CID 119019045) has the molecular formula C8H7F5N2 and a molecular weight of 226.15 g/mol. Its IUPAC name is 3-(difluoromethyl)-5-methyl-6-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 3-(difluoromethyl)-5-methyl-6-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 119019045 |
| Molecular Formula | C8H7F5N2 |
| Molecular Weight | 226.15 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | 3-(difluoromethyl)-5-methyl-6-(trifluoromethyl)pyridin-2-amine |
| SMILES | Cc1cc(C(F)F)c(N)nc1C(F)(F)F |
| InChI | InChI=1S/C8H7F5N2/c1-3-2-4(6(9)10)7(14)15-5(3)8(11,12)13/h2,6H,1H3,(H2,14,15) |
| InChIKey | KLAOFASYZRSSKO-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.15 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |