C11H8F6O2 — CID 119005128
1-[2-methoxy-4,6-bis(trifluoromethyl)phenyl]ethanone (PubChem CID 119005128) has the molecular formula C11H8F6O2 and a molecular weight of 286.17 g/mol. Its IUPAC name is 1-[2-methoxy-4,6-bis(trifluoromethyl)phenyl]ethanone.
| Compound Name | 1-[2-methoxy-4,6-bis(trifluoromethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 119005128 |
| Molecular Formula | C11H8F6O2 |
| Molecular Weight | 286.17 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | 1-[2-methoxy-4,6-bis(trifluoromethyl)phenyl]ethanone |
| SMILES | COc1cc(C(F)(F)F)cc(C(F)(F)F)c1C(C)=O |
| InChI | InChI=1S/C11H8F6O2/c1-5(18)9-7(11(15,16)17)3-6(10(12,13)14)4-8(9)19-2/h3-4H,1-2H3 |
| InChIKey | QGDKSPSXAZXPOX-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.17 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |