C19H26N4O2S2 — CID 11900518
N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-2-[[5-(2-methoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide (PubChem CID 11900518) has the molecular formula C19H26N4O2S2 and a molecular weight of 406.58 g/mol. Its IUPAC name is N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-2-[[5-(2-methoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-2-[[5-(2-methoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 11900518 |
| Molecular Formula | C19H26N4O2S2 |
| Molecular Weight | 406.58 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-2-[[5-(2-methoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
| SMILES | COc1ccccc1Nc1nnc(SCC(=O)N[C@@H]2CCC[C@@H](C)[C@H]2C)s1 |
| InChI | InChI=1S/C19H26N4O2S2/c1-12-7-6-9-14(13(12)2)20-17(24)11-26-19-23-22-18(27-19)21-15-8-4-5-10-16(15)25-3/h4-5,8,10,12-14H,6-7,9,11H2,1-3H3,(H,20,24)(H,21,22)/t12-,13-,14-/m1/s1 |
| InChIKey | DXFPTDLPEIIZCL-MGPQQGTHSA-N |
| XLogP | 4.32 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.58 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |