C18H23FN4OS2 — CID 11930798
N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-2-[[5-(3-fluoroanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide (PubChem CID 11930798) has the molecular formula C18H23FN4OS2 and a molecular weight of 394.54 g/mol. Its IUPAC name is N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-2-[[5-(3-fluoroanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-2-[[5-(3-fluoroanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 11930798 |
| Molecular Formula | C18H23FN4OS2 |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-2-[[5-(3-fluoroanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
| SMILES | C[C@@H]1[C@H](C)CCC[C@H]1NC(=O)CSc1nnc(Nc2cccc(F)c2)s1 |
| InChI | InChI=1S/C18H23FN4OS2/c1-11-5-3-8-15(12(11)2)21-16(24)10-25-18-23-22-17(26-18)20-14-7-4-6-13(19)9-14/h4,6-7,9,11-12,15H,3,5,8,10H2,1-2H3,(H,20,22)(H,21,24)/t11-,12-,15-/m1/s1 |
| InChIKey | ROSKSQIAEIGWBN-LALPHHSUSA-N |
| XLogP | 4.45 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |