C6H3Br2F2N — CID 119009471
2,5-dibromo-4-(difluoromethyl)pyridine (PubChem CID 119009471) has the molecular formula C6H3Br2F2N and a molecular weight of 286.90 g/mol. Its IUPAC name is 2,5-dibromo-4-(difluoromethyl)pyridine.
| Compound Name | 2,5-dibromo-4-(difluoromethyl)pyridine |
|---|---|
| PubChem CID | 119009471 |
| Molecular Formula | C6H3Br2F2N |
| Molecular Weight | 286.90 g/mol |
| Exact Mass | 284.86 |
| IUPAC Name | 2,5-dibromo-4-(difluoromethyl)pyridine |
| SMILES | FC(F)c1cc(Br)ncc1Br |
| InChI | InChI=1S/C6H3Br2F2N/c7-4-2-11-5(8)1-3(4)6(9)10/h1-2,6H |
| InChIKey | RAWOUVWQPRMOPD-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.90 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|