C13H19BrF2N2O — CID 118419804
5-[[6-bromo-4-(difluoromethyl)-3-pyridinyl]oxy]-2,4-dimethylpentan-2-amine (PubChem CID 118419804) has the molecular formula C13H19BrF2N2O and a molecular weight of 337.21 g/mol. Its IUPAC name is 5-[[6-bromo-4-(difluoromethyl)-3-pyridinyl]oxy]-2,4-dimethylpentan-2-amine.
| Compound Name | 5-[[6-bromo-4-(difluoromethyl)-3-pyridinyl]oxy]-2,4-dimethylpentan-2-amine |
|---|---|
| PubChem CID | 118419804 |
| Molecular Formula | C13H19BrF2N2O |
| Molecular Weight | 337.21 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | 5-[[6-bromo-4-(difluoromethyl)-3-pyridinyl]oxy]-2,4-dimethylpentan-2-amine |
| SMILES | CC(COc1cnc(Br)cc1C(F)F)CC(C)(C)N |
| InChI | InChI=1S/C13H19BrF2N2O/c1-8(5-13(2,3)17)7-19-10-6-18-11(14)4-9(10)12(15)16/h4,6,8,12H,5,7,17H2,1-3H3 |
| InChIKey | BEPAHGWSQMLXFF-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.21 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|