C8H8F2N2O — CID 119010249
6-amino-5-(difluoromethyl)-4-methylpyridine-2-carbaldehyde (PubChem CID 119010249) has the molecular formula C8H8F2N2O and a molecular weight of 186.16 g/mol. Its IUPAC name is 6-amino-5-(difluoromethyl)-4-methylpyridine-2-carbaldehyde.
| Compound Name | 6-amino-5-(difluoromethyl)-4-methylpyridine-2-carbaldehyde |
|---|---|
| PubChem CID | 119010249 |
| Molecular Formula | C8H8F2N2O |
| Molecular Weight | 186.16 g/mol |
| Exact Mass | 186.06 |
| IUPAC Name | 6-amino-5-(difluoromethyl)-4-methylpyridine-2-carbaldehyde |
| SMILES | Cc1cc(C=O)nc(N)c1C(F)F |
| InChI | InChI=1S/C8H8F2N2O/c1-4-2-5(3-13)12-8(11)6(4)7(9)10/h2-3,7H,1H3,(H2,11,12) |
| InChIKey | SOBCUEADHCTENN-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.16 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|