C15H27N2O+ — CID 11901264
dimethyl-[(1R,3S,4Z,6S)-3,7,7-trimethyl-4-prop-2-enoxyimino-3-bicyclo[4.1.0]heptanyl]azanium (PubChem CID 11901264) has the molecular formula C15H27N2O+ and a molecular weight of 251.39 g/mol. Its IUPAC name is dimethyl-[(1R,3S,4Z,6S)-3,7,7-trimethyl-4-prop-2-enoxyimino-3-bicyclo[4.1.0]heptanyl]azanium.
| Compound Name | dimethyl-[(1R,3S,4Z,6S)-3,7,7-trimethyl-4-prop-2-enoxyimino-3-bicyclo[4.1.0]heptanyl]azanium |
|---|---|
| PubChem CID | 11901264 |
| Molecular Formula | C15H27N2O+ |
| Molecular Weight | 251.39 g/mol |
| Exact Mass | 251.21 |
| IUPAC Name | dimethyl-[(1R,3S,4Z,6S)-3,7,7-trimethyl-4-prop-2-enoxyimino-3-bicyclo[4.1.0]heptanyl]azanium |
| SMILES | C=CCO/N=C1/C[C@H]2[C@@H](C[C@]1(C)[NH+](C)C)C2(C)C |
| InChI | InChI=1S/C15H26N2O/c1-7-8-18-16-13-9-11-12(14(11,2)3)10-15(13,4)17(5)6/h7,11-12H,1,8-10H2,2-6H3/p+1/b16-13-/t11-,12+,15-/m0/s1 |
| InChIKey | KDOWIRPIALEFSJ-GOTXEICISA-O |
| XLogP | 1.51 |
| TPSA | 26.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.39 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|