C13H8F6N2O — CID 119015031
5-[2-(trifluoromethoxy)phenyl]-3-(trifluoromethyl)pyridin-2-amine (PubChem CID 119015031) has the molecular formula C13H8F6N2O and a molecular weight of 322.21 g/mol. Its IUPAC name is 5-[2-(trifluoromethoxy)phenyl]-3-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 5-[2-(trifluoromethoxy)phenyl]-3-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 119015031 |
| Molecular Formula | C13H8F6N2O |
| Molecular Weight | 322.21 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | 5-[2-(trifluoromethoxy)phenyl]-3-(trifluoromethyl)pyridin-2-amine |
| SMILES | Nc1ncc(-c2ccccc2OC(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C13H8F6N2O/c14-12(15,16)9-5-7(6-21-11(9)20)8-3-1-2-4-10(8)22-13(17,18)19/h1-6H,(H2,20,21) |
| InChIKey | HQUWVQCSKSWALI-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.21 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |