C13H11F3N2O — CID 139370325
5-(2-methoxyphenyl)-3-(trifluoromethyl)pyridin-2-amine (PubChem CID 139370325) has the molecular formula C13H11F3N2O and a molecular weight of 268.24 g/mol. Its IUPAC name is 5-(2-methoxyphenyl)-3-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 5-(2-methoxyphenyl)-3-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 139370325 |
| Molecular Formula | C13H11F3N2O |
| Molecular Weight | 268.24 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 5-(2-methoxyphenyl)-3-(trifluoromethyl)pyridin-2-amine |
| SMILES | COc1ccccc1-c1cnc(N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H11F3N2O/c1-19-11-5-3-2-4-9(11)8-6-10(13(14,15)16)12(17)18-7-8/h2-7H,1H3,(H2,17,18) |
| InChIKey | PFDBZFUHKHDVBB-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.24 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |