C7H2Cl2F4 — CID 119018682
1,2-dichloro-5-fluoro-3-(trifluoromethyl)benzene (PubChem CID 119018682) has the molecular formula C7H2Cl2F4 and a molecular weight of 232.99 g/mol. Its IUPAC name is 1,2-dichloro-5-fluoro-3-(trifluoromethyl)benzene.
| Compound Name | 1,2-dichloro-5-fluoro-3-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 119018682 |
| Molecular Formula | C7H2Cl2F4 |
| Molecular Weight | 232.99 g/mol |
| Exact Mass | 231.95 |
| IUPAC Name | 1,2-dichloro-5-fluoro-3-(trifluoromethyl)benzene |
| SMILES | Fc1cc(Cl)c(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C7H2Cl2F4/c8-5-2-3(10)1-4(6(5)9)7(11,12)13/h1-2H |
| InChIKey | SXYPUXIFZGOMPP-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.99 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|