C12H3Cl5F3NO2 — CID 119019730
4-hydroxy-3-(2,3,4,5,6-pentachlorophenyl)-6-(trifluoromethyl)-1H-pyridin-2-one (PubChem CID 119019730) has the molecular formula C12H3Cl5F3NO2 and a molecular weight of 427.42 g/mol. Its IUPAC name is 4-hydroxy-3-(2,3,4,5,6-pentachlorophenyl)-6-(trifluoromethyl)-1H-pyridin-2-one.
| Compound Name | 4-hydroxy-3-(2,3,4,5,6-pentachlorophenyl)-6-(trifluoromethyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 119019730 |
| Molecular Formula | C12H3Cl5F3NO2 |
| Molecular Weight | 427.42 g/mol |
| Exact Mass | 424.86 |
| IUPAC Name | 4-hydroxy-3-(2,3,4,5,6-pentachlorophenyl)-6-(trifluoromethyl)-1H-pyridin-2-one |
| SMILES | O=c1[nH]c(C(F)(F)F)cc(O)c1-c1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C12H3Cl5F3NO2/c13-6-5(7(14)9(16)10(17)8(6)15)4-2(22)1-3(12(18,19)20)21-11(4)23/h1H,(H2,21,22,23) |
| InChIKey | QHZPKZINUJUDMB-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.42 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|