C18H19ClN2O3 — CID 119025597
1-[5-[2-chloro-5-(hydroxymethyl)phenyl]-2-pyridinyl]piperidine-4-carboxylic acid (PubChem CID 119025597) has the molecular formula C18H19ClN2O3 and a molecular weight of 346.81 g/mol. Its IUPAC name is 1-[5-[2-chloro-5-(hydroxymethyl)phenyl]-2-pyridinyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[5-[2-chloro-5-(hydroxymethyl)phenyl]-2-pyridinyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 119025597 |
| Molecular Formula | C18H19ClN2O3 |
| Molecular Weight | 346.81 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 1-[5-[2-chloro-5-(hydroxymethyl)phenyl]-2-pyridinyl]piperidine-4-carboxylic acid |
| SMILES | O=C(O)C1CCN(c2ccc(-c3cc(CO)ccc3Cl)cn2)CC1 |
| InChI | InChI=1S/C18H19ClN2O3/c19-16-3-1-12(11-22)9-15(16)14-2-4-17(20-10-14)21-7-5-13(6-8-21)18(23)24/h1-4,9-10,13,22H,5-8,11H2,(H,23,24) |
| InChIKey | ZHEDDGBFOGXDOY-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 73.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.81 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |