C8H10ClNO — CID 119031183
3,4-dihydro-1H-2,3-benzoxazine;hydrochloride (PubChem CID 119031183) has the molecular formula C8H10ClNO and a molecular weight of 171.63 g/mol. Its IUPAC name is 3,4-dihydro-1H-2,3-benzoxazine;hydrochloride.
| Compound Name | 3,4-dihydro-1H-2,3-benzoxazine;hydrochloride |
|---|---|
| PubChem CID | 119031183 |
| Molecular Formula | C8H10ClNO |
| Molecular Weight | 171.63 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | 3,4-dihydro-1H-2,3-benzoxazine;hydrochloride |
| SMILES | Cl.c1ccc2c(c1)CNOC2 |
| InChI | InChI=1S/C8H9NO.ClH/c1-2-4-8-6-10-9-5-7(8)3-1;/h1-4,9H,5-6H2;1H |
| InChIKey | IOWFVFYUKLHKIG-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.63 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |