About 2-cyclopropyl-3,3-dimethylazetidine;hydrochloride
2-cyclopropyl-3,3-dimethylazetidine;hydrochloride (PubChem CID 119031645) has the molecular formula C8H16ClN
and a molecular weight of 161.68 g/mol. Its IUPAC name is 2-cyclopropyl-3,3-dimethylazetidine;hydrochloride.
Molecular Properties
| Compound Name | 2-cyclopropyl-3,3-dimethylazetidine;hydrochloride |
| PubChem CID | 119031645 |
| Molecular Formula | C8H16ClN |
| Molecular Weight | 161.68 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | 2-cyclopropyl-3,3-dimethylazetidine;hydrochloride |
| SMILES | CC1(C)CNC1C1CC1.Cl |
| InChI | InChI=1S/C8H15N.ClH/c1-8(2)5-9-7(8)6-3-4-6;/h6-7,9H,3-5H2,1-2H3;1H |
| InChIKey | HIIGRPUBOAXFDC-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.68 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-cyclopropyl-3,3-dimethylazetidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-3,3-dimethylazetidine;hydrochloride?
The IUPAC name of 2-cyclopropyl-3,3-dimethylazetidine;hydrochloride (CID 119031645) is 2-cyclopropyl-3,3-dimethylazetidine;hydrochloride.
What is the SMILES notation for 2-cyclopropyl-3,3-dimethylazetidine;hydrochloride?
The canonical SMILES for 2-cyclopropyl-3,3-dimethylazetidine;hydrochloride is CC1(C)CNC1C1CC1.Cl.
What is the InChIKey of 2-cyclopropyl-3,3-dimethylazetidine;hydrochloride?
The InChIKey is HIIGRPUBOAXFDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N.ClH/c1-8(2)5-9-7(8)6-3-4-6;/h6-7,9H,3-5H2,1-2H3;1H.
What are the key properties of 2-cyclopropyl-3,3-dimethylazetidine;hydrochloride?
2-cyclopropyl-3,3-dimethylazetidine;hydrochloride has a molecular weight of 161.68 g/mol, XLogP of 1.82, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-3,3-dimethylazetidine;hydrochloride is sourced from PubChem (CID 119031645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).