C15H19Cl2NO6 — CID 11903210
N-[(2S,3R,4R,5S,6S)-2-[(2,4-dichlorophenyl)methoxy]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide (PubChem CID 11903210) has the molecular formula C15H19Cl2NO6 and a molecular weight of 380.22 g/mol. Its IUPAC name is N-[(2S,3R,4R,5S,6S)-2-[(2,4-dichlorophenyl)methoxy]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide.
| Compound Name | N-[(2S,3R,4R,5S,6S)-2-[(2,4-dichlorophenyl)methoxy]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 11903210 |
| Molecular Formula | C15H19Cl2NO6 |
| Molecular Weight | 380.22 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | N-[(2S,3R,4R,5S,6S)-2-[(2,4-dichlorophenyl)methoxy]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide |
| SMILES | CC(=O)N[C@H]1[C@@H](OCc2ccc(Cl)cc2Cl)O[C@@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H19Cl2NO6/c1-7(20)18-12-14(22)13(21)11(5-19)24-15(12)23-6-8-2-3-9(16)4-10(8)17/h2-4,11-15,19,21-22H,5-6H2,1H3,(H,18,20)/t11-,12+,13+,14+,15-/m0/s1 |
| InChIKey | CIHDSPCYFDFWRF-JARUQAPTSA-N |
| XLogP | 0.45 |
| TPSA | 108.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.22 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |