C17H18N2O3 — CID 119033513
6-methyl-2-oxo-N-(oxolan-3-yl)-5-phenyl-1H-pyridine-3-carboxamide (PubChem CID 119033513) has the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. Its IUPAC name is 6-methyl-2-oxo-N-(oxolan-3-yl)-5-phenyl-1H-pyridine-3-carboxamide.
| Compound Name | 6-methyl-2-oxo-N-(oxolan-3-yl)-5-phenyl-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 119033513 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 6-methyl-2-oxo-N-(oxolan-3-yl)-5-phenyl-1H-pyridine-3-carboxamide |
| SMILES | Cc1[nH]c(=O)c(C(=O)NC2CCOC2)cc1-c1ccccc1 |
| InChI | InChI=1S/C17H18N2O3/c1-11-14(12-5-3-2-4-6-12)9-15(16(20)18-11)17(21)19-13-7-8-22-10-13/h2-6,9,13H,7-8,10H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | RBMKZNXKNDKKRW-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |