C17H20N4O4 — CID 119034026
1-ethyl-4-[2-[5-[2-(furan-2-yl)cyclopropyl]-1,2,4-oxadiazol-3-yl]ethyl]piperazine-2,3-dione (PubChem CID 119034026) has the molecular formula C17H20N4O4 and a molecular weight of 344.37 g/mol. Its IUPAC name is 1-ethyl-4-[2-[5-[2-(furan-2-yl)cyclopropyl]-1,2,4-oxadiazol-3-yl]ethyl]piperazine-2,3-dione.
| Compound Name | 1-ethyl-4-[2-[5-[2-(furan-2-yl)cyclopropyl]-1,2,4-oxadiazol-3-yl]ethyl]piperazine-2,3-dione |
|---|---|
| PubChem CID | 119034026 |
| Molecular Formula | C17H20N4O4 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 1-ethyl-4-[2-[5-[2-(furan-2-yl)cyclopropyl]-1,2,4-oxadiazol-3-yl]ethyl]piperazine-2,3-dione |
| SMILES | CCN1CCN(CCc2noc(C3CC3c3ccco3)n2)C(=O)C1=O |
| InChI | InChI=1S/C17H20N4O4/c1-2-20-7-8-21(17(23)16(20)22)6-5-14-18-15(25-19-14)12-10-11(12)13-4-3-9-24-13/h3-4,9,11-12H,2,5-8,10H2,1H3 |
| InChIKey | RBYRCSGZYXUKSK-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 92.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|