About 1-[2-[(2,3-dichlorophenyl)methyl]pyrazol-3-yl]-3-(1-hydroxypropan-2-yl)urea
1-[2-[(2,3-dichlorophenyl)methyl]pyrazol-3-yl]-3-(1-hydroxypropan-2-yl)urea (PubChem CID 119034354) has the molecular formula C14H16Cl2N4O2
and a molecular weight of 343.21 g/mol. Its IUPAC name is 1-[2-[(2,3-dichlorophenyl)methyl]pyrazol-3-yl]-3-(1-hydroxypropan-2-yl)urea.
Molecular Properties
| Compound Name | 1-[2-[(2,3-dichlorophenyl)methyl]pyrazol-3-yl]-3-(1-hydroxypropan-2-yl)urea |
| PubChem CID | 119034354 |
| Molecular Formula | C14H16Cl2N4O2 |
| Molecular Weight | 343.21 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | 1-[2-[(2,3-dichlorophenyl)methyl]pyrazol-3-yl]-3-(1-hydroxypropan-2-yl)urea |
| SMILES | CC(CO)NC(=O)Nc1ccnn1Cc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C14H16Cl2N4O2/c1-9(8-21)18-14(22)19-12-5-6-17-20(12)7-10-3-2-4-11(15)13(10)16/h2-6,9,21H,7-8H2,1H3,(H2,18,19,22) |
| InChIKey | IAKJTQWWZHCLBO-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.21 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[2-[(2,3-dichlorophenyl)methyl]pyrazol-3-yl]-3-(1-hydroxypropan-2-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[(2,3-dichlorophenyl)methyl]pyrazol-3-yl]-3-(1-hydroxypropan-2-yl)urea?
The IUPAC name of 1-[2-[(2,3-dichlorophenyl)methyl]pyrazol-3-yl]-3-(1-hydroxypropan-2-yl)urea (CID 119034354) is 1-[2-[(2,3-dichlorophenyl)methyl]pyrazol-3-yl]-3-(1-hydroxypropan-2-yl)urea.
What is the SMILES notation for 1-[2-[(2,3-dichlorophenyl)methyl]pyrazol-3-yl]-3-(1-hydroxypropan-2-yl)urea?
The canonical SMILES for 1-[2-[(2,3-dichlorophenyl)methyl]pyrazol-3-yl]-3-(1-hydroxypropan-2-yl)urea is CC(CO)NC(=O)Nc1ccnn1Cc1cccc(Cl)c1Cl.
What is the InChIKey of 1-[2-[(2,3-dichlorophenyl)methyl]pyrazol-3-yl]-3-(1-hydroxypropan-2-yl)urea?
The InChIKey is IAKJTQWWZHCLBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16Cl2N4O2/c1-9(8-21)18-14(22)19-12-5-6-17-20(12)7-10-3-2-4-11(15)13(10)16/h2-6,9,21H,7-8H2,1H3,(H2,18,19,22).
What are the key properties of 1-[2-[(2,3-dichlorophenyl)methyl]pyrazol-3-yl]-3-(1-hydroxypropan-2-yl)urea?
1-[2-[(2,3-dichlorophenyl)methyl]pyrazol-3-yl]-3-(1-hydroxypropan-2-yl)urea has a molecular weight of 343.21 g/mol, XLogP of 2.74, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[(2,3-dichlorophenyl)methyl]pyrazol-3-yl]-3-(1-hydroxypropan-2-yl)urea is sourced from PubChem (CID 119034354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).