About N-[2-[(2,3-dichlorophenyl)methyl]pyrazol-3-yl]piperidine-4-carboxamide;hydrochloride
N-[2-[(2,3-dichlorophenyl)methyl]pyrazol-3-yl]piperidine-4-carboxamide;hydrochloride (PubChem CID 119274816) has the molecular formula C16H19Cl3N4O
and a molecular weight of 389.71 g/mol. Its IUPAC name is N-[2-[(2,3-dichlorophenyl)methyl]pyrazol-3-yl]piperidine-4-carboxamide;hydrochloride.
Molecular Properties
| Compound Name | N-[2-[(2,3-dichlorophenyl)methyl]pyrazol-3-yl]piperidine-4-carboxamide;hydrochloride |
| PubChem CID | 119274816 |
| Molecular Formula | C16H19Cl3N4O |
| Molecular Weight | 389.71 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | N-[2-[(2,3-dichlorophenyl)methyl]pyrazol-3-yl]piperidine-4-carboxamide;hydrochloride |
| SMILES | Cl.O=C(Nc1ccnn1Cc1cccc(Cl)c1Cl)C1CCNCC1 |
| InChI | InChI=1S/C16H18Cl2N4O.ClH/c17-13-3-1-2-12(15(13)18)10-22-14(6-9-20-22)21-16(23)11-4-7-19-8-5-11;/h1-3,6,9,11,19H,4-5,7-8,10H2,(H,21,23);1H |
| InChIKey | DBCKIUADXKAVIQ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.71 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[2-[(2,3-dichlorophenyl)methyl]pyrazol-3-yl]piperidine-4-carboxamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[(2,3-dichlorophenyl)methyl]pyrazol-3-yl]piperidine-4-carboxamide;hydrochloride?
The IUPAC name of N-[2-[(2,3-dichlorophenyl)methyl]pyrazol-3-yl]piperidine-4-carboxamide;hydrochloride (CID 119274816) is N-[2-[(2,3-dichlorophenyl)methyl]pyrazol-3-yl]piperidine-4-carboxamide;hydrochloride.
What is the SMILES notation for N-[2-[(2,3-dichlorophenyl)methyl]pyrazol-3-yl]piperidine-4-carboxamide;hydrochloride?
The canonical SMILES for N-[2-[(2,3-dichlorophenyl)methyl]pyrazol-3-yl]piperidine-4-carboxamide;hydrochloride is Cl.O=C(Nc1ccnn1Cc1cccc(Cl)c1Cl)C1CCNCC1.
What is the InChIKey of N-[2-[(2,3-dichlorophenyl)methyl]pyrazol-3-yl]piperidine-4-carboxamide;hydrochloride?
The InChIKey is DBCKIUADXKAVIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18Cl2N4O.ClH/c17-13-3-1-2-12(15(13)18)10-22-14(6-9-20-22)21-16(23)11-4-7-19-8-5-11;/h1-3,6,9,11,19H,4-5,7-8,10H2,(H,21,23);1H.
What are the key properties of N-[2-[(2,3-dichlorophenyl)methyl]pyrazol-3-yl]piperidine-4-carboxamide;hydrochloride?
N-[2-[(2,3-dichlorophenyl)methyl]pyrazol-3-yl]piperidine-4-carboxamide;hydrochloride has a molecular weight of 389.71 g/mol, XLogP of 3.60, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[(2,3-dichlorophenyl)methyl]pyrazol-3-yl]piperidine-4-carboxamide;hydrochloride is sourced from PubChem (CID 119274816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).