C24H32Cl2N4O — CID 135843739
7-(3,4-dichlorophenyl)-5-methyl-N,N-dipentyl-4,7-dihydropyrazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135843739) has the molecular formula C24H32Cl2N4O and a molecular weight of 463.45 g/mol. Its IUPAC name is 7-(3,4-dichlorophenyl)-5-methyl-N,N-dipentyl-4,7-dihydropyrazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 7-(3,4-dichlorophenyl)-5-methyl-N,N-dipentyl-4,7-dihydropyrazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135843739 |
| Molecular Formula | C24H32Cl2N4O |
| Molecular Weight | 463.45 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | 7-(3,4-dichlorophenyl)-5-methyl-N,N-dipentyl-4,7-dihydropyrazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CCCCCN(CCCCC)C(=O)C1=C(C)Nc2ccnn2C1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C24H32Cl2N4O/c1-4-6-8-14-29(15-9-7-5-2)24(31)22-17(3)28-21-12-13-27-30(21)23(22)18-10-11-19(25)20(26)16-18/h10-13,16,23,28H,4-9,14-15H2,1-3H3 |
| InChIKey | HMGXPGMZAJUVKU-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.45 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|