C21H23Cl2N5O4S — CID 135463485
7-(3,4-dichlorophenyl)-N-ethyl-2,5-dimethyl-N-[(3-methyl-4,5-dihydro-1,2-oxazol-4-yl)sulfonyl]-4,7-dihydropyrazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135463485) has the molecular formula C21H23Cl2N5O4S and a molecular weight of 512.42 g/mol. Its IUPAC name is 7-(3,4-dichlorophenyl)-N-ethyl-2,5-dimethyl-N-[(3-methyl-4,5-dihydro-1,2-oxazol-4-yl)sulfonyl]-4,7-dihydropyrazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 7-(3,4-dichlorophenyl)-N-ethyl-2,5-dimethyl-N-[(3-methyl-4,5-dihydro-1,2-oxazol-4-yl)sulfonyl]-4,7-dihydropyrazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135463485 |
| Molecular Formula | C21H23Cl2N5O4S |
| Molecular Weight | 512.42 g/mol |
| Exact Mass | 511.08 |
| IUPAC Name | 7-(3,4-dichlorophenyl)-N-ethyl-2,5-dimethyl-N-[(3-methyl-4,5-dihydro-1,2-oxazol-4-yl)sulfonyl]-4,7-dihydropyrazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CCN(C(=O)C1=C(C)Nc2cc(C)nn2C1c1ccc(Cl)c(Cl)c1)S(=O)(=O)C1CON=C1C |
| InChI | InChI=1S/C21H23Cl2N5O4S/c1-5-27(33(30,31)17-10-32-26-12(17)3)21(29)19-13(4)24-18-8-11(2)25-28(18)20(19)14-6-7-15(22)16(23)9-14/h6-9,17,20,24H,5,10H2,1-4H3 |
| InChIKey | UTXWJMVJGGJVEC-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 105.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.42 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |