C21H24Cl2N4O3 — CID 135843830
[7-(3,4-dichlorophenyl)-5-methyl-4,7-dihydropyrazolo[1,5-a]pyrimidin-6-yl]-[2-(methoxymethoxymethyl)pyrrolidin-1-yl]methanone (PubChem CID 135843830) has the molecular formula C21H24Cl2N4O3 and a molecular weight of 451.35 g/mol. Its IUPAC name is [7-(3,4-dichlorophenyl)-5-methyl-4,7-dihydropyrazolo[1,5-a]pyrimidin-6-yl]-[2-(methoxymethoxymethyl)pyrrolidin-1-yl]methanone.
| Compound Name | [7-(3,4-dichlorophenyl)-5-methyl-4,7-dihydropyrazolo[1,5-a]pyrimidin-6-yl]-[2-(methoxymethoxymethyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 135843830 |
| Molecular Formula | C21H24Cl2N4O3 |
| Molecular Weight | 451.35 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | [7-(3,4-dichlorophenyl)-5-methyl-4,7-dihydropyrazolo[1,5-a]pyrimidin-6-yl]-[2-(methoxymethoxymethyl)pyrrolidin-1-yl]methanone |
| SMILES | COCOCC1CCCN1C(=O)C1=C(C)Nc2ccnn2C1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H24Cl2N4O3/c1-13-19(21(28)26-9-3-4-15(26)11-30-12-29-2)20(27-18(25-13)7-8-24-27)14-5-6-16(22)17(23)10-14/h5-8,10,15,20,25H,3-4,9,11-12H2,1-2H3 |
| InChIKey | CTZIVHWNIUHSHJ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.35 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|