C22H20Cl2N4O2 — CID 135843906
7-(3,4-dichlorophenyl)-5-methyl-N-(2-phenoxyethyl)-4,7-dihydropyrazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135843906) has the molecular formula C22H20Cl2N4O2 and a molecular weight of 443.33 g/mol. Its IUPAC name is 7-(3,4-dichlorophenyl)-5-methyl-N-(2-phenoxyethyl)-4,7-dihydropyrazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 7-(3,4-dichlorophenyl)-5-methyl-N-(2-phenoxyethyl)-4,7-dihydropyrazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135843906 |
| Molecular Formula | C22H20Cl2N4O2 |
| Molecular Weight | 443.33 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | 7-(3,4-dichlorophenyl)-5-methyl-N-(2-phenoxyethyl)-4,7-dihydropyrazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(=O)NCCOc2ccccc2)C(c2ccc(Cl)c(Cl)c2)n2nccc2N1 |
| InChI | InChI=1S/C22H20Cl2N4O2/c1-14-20(22(29)25-11-12-30-16-5-3-2-4-6-16)21(28-19(27-14)9-10-26-28)15-7-8-17(23)18(24)13-15/h2-10,13,21,27H,11-12H2,1H3,(H,25,29) |
| InChIKey | OPEDVHXHQBSXMV-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.33 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|