C23H28FN3O — CID 119034389
[7-(dimethylamino)-3,4-dihydro-1H-isoquinolin-2-yl]-[1-[(4-fluorophenyl)methyl]pyrrolidin-2-yl]methanone (PubChem CID 119034389) has the molecular formula C23H28FN3O and a molecular weight of 381.50 g/mol. Its IUPAC name is [7-(dimethylamino)-3,4-dihydro-1H-isoquinolin-2-yl]-[1-[(4-fluorophenyl)methyl]pyrrolidin-2-yl]methanone.
| Compound Name | [7-(dimethylamino)-3,4-dihydro-1H-isoquinolin-2-yl]-[1-[(4-fluorophenyl)methyl]pyrrolidin-2-yl]methanone |
|---|---|
| PubChem CID | 119034389 |
| Molecular Formula | C23H28FN3O |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | [7-(dimethylamino)-3,4-dihydro-1H-isoquinolin-2-yl]-[1-[(4-fluorophenyl)methyl]pyrrolidin-2-yl]methanone |
| SMILES | CN(C)c1ccc2c(c1)CN(C(=O)C1CCCN1Cc1ccc(F)cc1)CC2 |
| InChI | InChI=1S/C23H28FN3O/c1-25(2)21-10-7-18-11-13-27(16-19(18)14-21)23(28)22-4-3-12-26(22)15-17-5-8-20(24)9-6-17/h5-10,14,22H,3-4,11-13,15-16H2,1-2H3 |
| InChIKey | KGAAIIYGWSTVPZ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|