C17H17NO5 — CID 11903576
(2-anilino-2-oxoethyl) (1R,3R,6S,7R,9S)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate (PubChem CID 11903576) has the molecular formula C17H17NO5 and a molecular weight of 315.32 g/mol. Its IUPAC name is (2-anilino-2-oxoethyl) (1R,3R,6S,7R,9S)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate.
| Compound Name | (2-anilino-2-oxoethyl) (1R,3R,6S,7R,9S)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
|---|---|
| PubChem CID | 11903576 |
| Molecular Formula | C17H17NO5 |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | (2-anilino-2-oxoethyl) (1R,3R,6S,7R,9S)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
| SMILES | O=C(COC(=O)[C@H]1[C@@H]2C[C@@H]3[C@@H]1C(=O)O[C@@H]3C2)Nc1ccccc1 |
| InChI | InChI=1S/C17H17NO5/c19-13(18-10-4-2-1-3-5-10)8-22-16(20)14-9-6-11-12(7-9)23-17(21)15(11)14/h1-5,9,11-12,14-15H,6-8H2,(H,18,19)/t9-,11+,12-,14+,15+/m1/s1 |
| InChIKey | NEQHLTQAFZUKDB-OGGHUHLFSA-N |
| XLogP | 1.37 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |