C21H25NO5 — CID 7424489
[2-(2,6-diethylanilino)-2-oxoethyl] (1R,3S,6R,7R,9R)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate (PubChem CID 7424489) has the molecular formula C21H25NO5 and a molecular weight of 371.43 g/mol. Its IUPAC name is [2-(2,6-diethylanilino)-2-oxoethyl] (1R,3S,6R,7R,9R)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate.
| Compound Name | [2-(2,6-diethylanilino)-2-oxoethyl] (1R,3S,6R,7R,9R)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
|---|---|
| PubChem CID | 7424489 |
| Molecular Formula | C21H25NO5 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | [2-(2,6-diethylanilino)-2-oxoethyl] (1R,3S,6R,7R,9R)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
| SMILES | CCc1cccc(CC)c1NC(=O)COC(=O)[C@@H]1[C@@H]2C[C@@H]3[C@H]1C(=O)O[C@H]3C2 |
| InChI | InChI=1S/C21H25NO5/c1-3-11-6-5-7-12(4-2)19(11)22-16(23)10-26-20(24)17-13-8-14-15(9-13)27-21(25)18(14)17/h5-7,13-15,17-18H,3-4,8-10H2,1-2H3,(H,22,23)/t13-,14+,15+,17-,18-/m1/s1 |
| InChIKey | VPRFJIZEFDHWAX-MISMHTLLSA-N |
| XLogP | 2.49 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |