C21H22N2O — CID 119035768
N-[(4-methylphenyl)methyl]-N-prop-2-ynyl-5,6,7,8-tetrahydroquinoline-8-carboxamide (PubChem CID 119035768) has the molecular formula C21H22N2O and a molecular weight of 318.42 g/mol. Its IUPAC name is N-[(4-methylphenyl)methyl]-N-prop-2-ynyl-5,6,7,8-tetrahydroquinoline-8-carboxamide.
| Compound Name | N-[(4-methylphenyl)methyl]-N-prop-2-ynyl-5,6,7,8-tetrahydroquinoline-8-carboxamide |
|---|---|
| PubChem CID | 119035768 |
| Molecular Formula | C21H22N2O |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | N-[(4-methylphenyl)methyl]-N-prop-2-ynyl-5,6,7,8-tetrahydroquinoline-8-carboxamide |
| SMILES | C#CCN(Cc1ccc(C)cc1)C(=O)C1CCCc2cccnc21 |
| InChI | InChI=1S/C21H22N2O/c1-3-14-23(15-17-11-9-16(2)10-12-17)21(24)19-8-4-6-18-7-5-13-22-20(18)19/h1,5,7,9-13,19H,4,6,8,14-15H2,2H3 |
| InChIKey | WOQPZDZPUPISMH-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|