C18H21ClN6O3 — CID 119036537
5-[1-[(3-chloro-4-pyrrolidin-1-ylphenyl)carbamoyl]pyrrolidin-2-yl]-1,2,4-oxadiazole-3-carboxamide (PubChem CID 119036537) has the molecular formula C18H21ClN6O3 and a molecular weight of 404.86 g/mol. Its IUPAC name is 5-[1-[(3-chloro-4-pyrrolidin-1-ylphenyl)carbamoyl]pyrrolidin-2-yl]-1,2,4-oxadiazole-3-carboxamide.
| Compound Name | 5-[1-[(3-chloro-4-pyrrolidin-1-ylphenyl)carbamoyl]pyrrolidin-2-yl]-1,2,4-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 119036537 |
| Molecular Formula | C18H21ClN6O3 |
| Molecular Weight | 404.86 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 5-[1-[(3-chloro-4-pyrrolidin-1-ylphenyl)carbamoyl]pyrrolidin-2-yl]-1,2,4-oxadiazole-3-carboxamide |
| SMILES | NC(=O)c1noc(C2CCCN2C(=O)Nc2ccc(N3CCCC3)c(Cl)c2)n1 |
| InChI | InChI=1S/C18H21ClN6O3/c19-12-10-11(5-6-13(12)24-7-1-2-8-24)21-18(27)25-9-3-4-14(25)17-22-16(15(20)26)23-28-17/h5-6,10,14H,1-4,7-9H2,(H2,20,26)(H,21,27) |
| InChIKey | OTSAAJPVSYACKW-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.86 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|