C14H13ClN6O5 — CID 100720445
5-[(2R)-1-[(4-chloro-3-nitrophenyl)carbamoyl]pyrrolidin-2-yl]-1,2,4-oxadiazole-3-carboxamide (PubChem CID 100720445) has the molecular formula C14H13ClN6O5 and a molecular weight of 380.75 g/mol. Its IUPAC name is 5-[(2R)-1-[(4-chloro-3-nitrophenyl)carbamoyl]pyrrolidin-2-yl]-1,2,4-oxadiazole-3-carboxamide.
| Compound Name | 5-[(2R)-1-[(4-chloro-3-nitrophenyl)carbamoyl]pyrrolidin-2-yl]-1,2,4-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 100720445 |
| Molecular Formula | C14H13ClN6O5 |
| Molecular Weight | 380.75 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | 5-[(2R)-1-[(4-chloro-3-nitrophenyl)carbamoyl]pyrrolidin-2-yl]-1,2,4-oxadiazole-3-carboxamide |
| SMILES | NC(=O)c1noc([C@H]2CCCN2C(=O)Nc2ccc(Cl)c([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C14H13ClN6O5/c15-8-4-3-7(6-10(8)21(24)25)17-14(23)20-5-1-2-9(20)13-18-12(11(16)22)19-26-13/h3-4,6,9H,1-2,5H2,(H2,16,22)(H,17,23)/t9-/m1/s1 |
| InChIKey | UDNNXCSGDNXCGY-SECBINFHSA-N |
| XLogP | 2.10 |
| TPSA | 157.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.75 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|