C29H31N5O4 — CID 119037689
1-[5-(4-methoxyphenyl)-3-(4-methylphenyl)-3,4-dihydropyrazol-2-yl]-2-[4-(4-nitrophenyl)piperazin-1-yl]ethanone (PubChem CID 119037689) has the molecular formula C29H31N5O4 and a molecular weight of 513.60 g/mol. Its IUPAC name is 1-[5-(4-methoxyphenyl)-3-(4-methylphenyl)-3,4-dihydropyrazol-2-yl]-2-[4-(4-nitrophenyl)piperazin-1-yl]ethanone.
| Compound Name | 1-[5-(4-methoxyphenyl)-3-(4-methylphenyl)-3,4-dihydropyrazol-2-yl]-2-[4-(4-nitrophenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 119037689 |
| Molecular Formula | C29H31N5O4 |
| Molecular Weight | 513.60 g/mol |
| Exact Mass | 513.24 |
| IUPAC Name | 1-[5-(4-methoxyphenyl)-3-(4-methylphenyl)-3,4-dihydropyrazol-2-yl]-2-[4-(4-nitrophenyl)piperazin-1-yl]ethanone |
| SMILES | COc1ccc(C2=NN(C(=O)CN3CCN(c4ccc([N+](=O)[O-])cc4)CC3)C(c3ccc(C)cc3)C2)cc1 |
| InChI | InChI=1S/C29H31N5O4/c1-21-3-5-23(6-4-21)28-19-27(22-7-13-26(38-2)14-8-22)30-33(28)29(35)20-31-15-17-32(18-16-31)24-9-11-25(12-10-24)34(36)37/h3-14,28H,15-20H2,1-2H3 |
| InChIKey | YSHCGSODMYOYND-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 91.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.60 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|