C17H16F2N4O2 — CID 119038149
8-(2,6-difluoro-4-nitrophenyl)-3-(2-methylpyrazol-3-yl)-8-azabicyclo[3.2.1]oct-2-ene (PubChem CID 119038149) has the molecular formula C17H16F2N4O2 and a molecular weight of 346.34 g/mol. Its IUPAC name is 8-(2,6-difluoro-4-nitrophenyl)-3-(2-methylpyrazol-3-yl)-8-azabicyclo[3.2.1]oct-2-ene.
| Compound Name | 8-(2,6-difluoro-4-nitrophenyl)-3-(2-methylpyrazol-3-yl)-8-azabicyclo[3.2.1]oct-2-ene |
|---|---|
| PubChem CID | 119038149 |
| Molecular Formula | C17H16F2N4O2 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 8-(2,6-difluoro-4-nitrophenyl)-3-(2-methylpyrazol-3-yl)-8-azabicyclo[3.2.1]oct-2-ene |
| SMILES | Cn1nccc1C1=CC2CCC(C1)N2c1c(F)cc([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C17H16F2N4O2/c1-21-16(4-5-20-21)10-6-11-2-3-12(7-10)22(11)17-14(18)8-13(23(24)25)9-15(17)19/h4-6,8-9,11-12H,2-3,7H2,1H3 |
| InChIKey | NLUGPEXLTSHNLV-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 64.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|