C16H21ClN2O4 — CID 119039762
4-chloro-N-[1-[[3-(2-hydroxyethyl)oxolan-3-yl]amino]-1-oxopropan-2-yl]benzamide (PubChem CID 119039762) has the molecular formula C16H21ClN2O4 and a molecular weight of 340.81 g/mol. Its IUPAC name is 4-chloro-N-[1-[[3-(2-hydroxyethyl)oxolan-3-yl]amino]-1-oxopropan-2-yl]benzamide.
| Compound Name | 4-chloro-N-[1-[[3-(2-hydroxyethyl)oxolan-3-yl]amino]-1-oxopropan-2-yl]benzamide |
|---|---|
| PubChem CID | 119039762 |
| Molecular Formula | C16H21ClN2O4 |
| Molecular Weight | 340.81 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 4-chloro-N-[1-[[3-(2-hydroxyethyl)oxolan-3-yl]amino]-1-oxopropan-2-yl]benzamide |
| SMILES | CC(NC(=O)c1ccc(Cl)cc1)C(=O)NC1(CCO)CCOC1 |
| InChI | InChI=1S/C16H21ClN2O4/c1-11(18-15(22)12-2-4-13(17)5-3-12)14(21)19-16(6-8-20)7-9-23-10-16/h2-5,11,20H,6-10H2,1H3,(H,18,22)(H,19,21) |
| InChIKey | ZPKUJYWEYHBELT-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.81 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |