C15H18N4O2 — CID 119039946
7H-purin-8-ylmethyl 2-(2-bicyclo[2.2.1]heptanyl)acetate (PubChem CID 119039946) has the molecular formula C15H18N4O2 and a molecular weight of 286.33 g/mol. Its IUPAC name is 7H-purin-8-ylmethyl 2-(2-bicyclo[2.2.1]heptanyl)acetate.
| Compound Name | 7H-purin-8-ylmethyl 2-(2-bicyclo[2.2.1]heptanyl)acetate |
|---|---|
| PubChem CID | 119039946 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 7H-purin-8-ylmethyl 2-(2-bicyclo[2.2.1]heptanyl)acetate |
| SMILES | O=C(CC1CC2CCC1C2)OCc1nc2ncncc2[nH]1 |
| InChI | InChI=1S/C15H18N4O2/c20-14(5-11-4-9-1-2-10(11)3-9)21-7-13-18-12-6-16-8-17-15(12)19-13/h6,8-11H,1-5,7H2,(H,16,17,18,19) |
| InChIKey | ZUJUDQHJOFUADC-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |