C14H19N3O2 — CID 71913282
(4-aminopyrimidin-5-yl)methyl 2-(2-bicyclo[2.2.1]heptanyl)acetate (PubChem CID 71913282) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is (4-aminopyrimidin-5-yl)methyl 2-(2-bicyclo[2.2.1]heptanyl)acetate.
| Compound Name | (4-aminopyrimidin-5-yl)methyl 2-(2-bicyclo[2.2.1]heptanyl)acetate |
|---|---|
| PubChem CID | 71913282 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | (4-aminopyrimidin-5-yl)methyl 2-(2-bicyclo[2.2.1]heptanyl)acetate |
| SMILES | Nc1ncncc1COC(=O)CC1CC2CCC1C2 |
| InChI | InChI=1S/C14H19N3O2/c15-14-12(6-16-8-17-14)7-19-13(18)5-11-4-9-1-2-10(11)3-9/h6,8-11H,1-5,7H2,(H2,15,16,17) |
| InChIKey | BQCRNQOWYARYKB-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |