C18H30N2O3SSi — CID 119040530
N-[[1-[2-(4-trimethylsilylphenyl)acetyl]piperidin-3-yl]methyl]methanesulfonamide (PubChem CID 119040530) has the molecular formula C18H30N2O3SSi and a molecular weight of 382.60 g/mol. Its IUPAC name is N-[[1-[2-(4-trimethylsilylphenyl)acetyl]piperidin-3-yl]methyl]methanesulfonamide.
| Compound Name | N-[[1-[2-(4-trimethylsilylphenyl)acetyl]piperidin-3-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 119040530 |
| Molecular Formula | C18H30N2O3SSi |
| Molecular Weight | 382.60 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | N-[[1-[2-(4-trimethylsilylphenyl)acetyl]piperidin-3-yl]methyl]methanesulfonamide |
| SMILES | C[Si](C)(C)c1ccc(CC(=O)N2CCCC(CNS(C)(=O)=O)C2)cc1 |
| InChI | InChI=1S/C18H30N2O3SSi/c1-24(22,23)19-13-16-6-5-11-20(14-16)18(21)12-15-7-9-17(10-8-15)25(2,3)4/h7-10,16,19H,5-6,11-14H2,1-4H3 |
| InChIKey | QFTQABSESZCKDZ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.60 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|