C15H18N2O4 — CID 119040569
methyl N-[4-(2-oxo-1-prop-2-enylpyrrolidin-3-yl)oxyphenyl]carbamate (PubChem CID 119040569) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is methyl N-[4-(2-oxo-1-prop-2-enylpyrrolidin-3-yl)oxyphenyl]carbamate.
| Compound Name | methyl N-[4-(2-oxo-1-prop-2-enylpyrrolidin-3-yl)oxyphenyl]carbamate |
|---|---|
| PubChem CID | 119040569 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | methyl N-[4-(2-oxo-1-prop-2-enylpyrrolidin-3-yl)oxyphenyl]carbamate |
| SMILES | C=CCN1CCC(Oc2ccc(NC(=O)OC)cc2)C1=O |
| InChI | InChI=1S/C15H18N2O4/c1-3-9-17-10-8-13(14(17)18)21-12-6-4-11(5-7-12)16-15(19)20-2/h3-7,13H,1,8-10H2,2H3,(H,16,19) |
| InChIKey | UQLKRIREWSRRNS-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|