C13H16BrClN2O5S — CID 119040582
3-bromo-2-chloro-N-methyl-5-nitro-N-(oxan-2-ylmethyl)benzenesulfonamide (PubChem CID 119040582) has the molecular formula C13H16BrClN2O5S and a molecular weight of 427.70 g/mol. Its IUPAC name is 3-bromo-2-chloro-N-methyl-5-nitro-N-(oxan-2-ylmethyl)benzenesulfonamide.
| Compound Name | 3-bromo-2-chloro-N-methyl-5-nitro-N-(oxan-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 119040582 |
| Molecular Formula | C13H16BrClN2O5S |
| Molecular Weight | 427.70 g/mol |
| Exact Mass | 425.97 |
| IUPAC Name | 3-bromo-2-chloro-N-methyl-5-nitro-N-(oxan-2-ylmethyl)benzenesulfonamide |
| SMILES | CN(CC1CCCCO1)S(=O)(=O)c1cc([N+](=O)[O-])cc(Br)c1Cl |
| InChI | InChI=1S/C13H16BrClN2O5S/c1-16(8-10-4-2-3-5-22-10)23(20,21)12-7-9(17(18)19)6-11(14)13(12)15/h6-7,10H,2-5,8H2,1H3 |
| InChIKey | AUEPGRZRIVDAGL-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.70 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|