C16H18F3N9 — CID 119041152
N-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]-2-(trifluoromethyl)-7H-purin-6-amine (PubChem CID 119041152) has the molecular formula C16H18F3N9 and a molecular weight of 393.38 g/mol. Its IUPAC name is N-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]-2-(trifluoromethyl)-7H-purin-6-amine.
| Compound Name | N-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]-2-(trifluoromethyl)-7H-purin-6-amine |
|---|---|
| PubChem CID | 119041152 |
| Molecular Formula | C16H18F3N9 |
| Molecular Weight | 393.38 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | N-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]-2-(trifluoromethyl)-7H-purin-6-amine |
| SMILES | FC(F)(F)c1nc(NCCN2CCN(c3ncccn3)CC2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C16H18F3N9/c17-16(18,19)14-25-12(11-13(26-14)24-10-23-11)20-4-5-27-6-8-28(9-7-27)15-21-2-1-3-22-15/h1-3,10H,4-9H2,(H2,20,23,24,25,26) |
| InChIKey | XVZRLYYTSUESDA-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 98.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.38 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |